C27H26Cl2N2O4S — CID 21169280
ethyl 4-[(2,4-dichlorophenyl)methyl-[(3-propan-2-yloxybenzoyl)carbamothioyl]amino]benzoate (PubChem CID 21169280) has the molecular formula C27H26Cl2N2O4S and a molecular weight of 545.49 g/mol. Its IUPAC name is ethyl 4-[(2,4-dichlorophenyl)methyl-[(3-propan-2-yloxybenzoyl)carbamothioyl]amino]benzoate.
| Compound Name | ethyl 4-[(2,4-dichlorophenyl)methyl-[(3-propan-2-yloxybenzoyl)carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 21169280 |
| Molecular Formula | C27H26Cl2N2O4S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | ethyl 4-[(2,4-dichlorophenyl)methyl-[(3-propan-2-yloxybenzoyl)carbamothioyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccc(Cl)cc2Cl)C(=S)NC(=O)c2cccc(OC(C)C)c2)cc1 |
| InChI | InChI=1S/C27H26Cl2N2O4S/c1-4-34-26(33)18-9-12-22(13-10-18)31(16-20-8-11-21(28)15-24(20)29)27(36)30-25(32)19-6-5-7-23(14-19)35-17(2)3/h5-15,17H,4,16H2,1-3H3,(H,30,32,36) |
| InChIKey | ZFEKQIDKXXBLBI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|