C24H22ClN3O3S — CID 23096335
ethyl 4-[(2-chloro-4-methylbenzoyl)carbamothioyl-(pyridin-3-ylmethyl)amino]benzoate (PubChem CID 23096335) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-4-methylbenzoyl)carbamothioyl-(pyridin-3-ylmethyl)amino]benzoate.
| Compound Name | ethyl 4-[(2-chloro-4-methylbenzoyl)carbamothioyl-(pyridin-3-ylmethyl)amino]benzoate |
|---|---|
| PubChem CID | 23096335 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | ethyl 4-[(2-chloro-4-methylbenzoyl)carbamothioyl-(pyridin-3-ylmethyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2cccnc2)C(=S)NC(=O)c2ccc(C)cc2Cl)cc1 |
| InChI | InChI=1S/C24H22ClN3O3S/c1-3-31-23(30)18-7-9-19(10-8-18)28(15-17-5-4-12-26-14-17)24(32)27-22(29)20-11-6-16(2)13-21(20)25/h4-14H,3,15H2,1-2H3,(H,27,29,32) |
| InChIKey | VHHUHIQAMOVORS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|