C27H29N3O5S — CID 23100773
ethyl 4-[(3,5-diethoxybenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate (PubChem CID 23100773) has the molecular formula C27H29N3O5S and a molecular weight of 507.61 g/mol. Its IUPAC name is ethyl 4-[(3,5-diethoxybenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate.
| Compound Name | ethyl 4-[(3,5-diethoxybenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate |
|---|---|
| PubChem CID | 23100773 |
| Molecular Formula | C27H29N3O5S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | ethyl 4-[(3,5-diethoxybenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccncc2)C(=S)NC(=O)c2cc(OCC)cc(OCC)c2)cc1 |
| InChI | InChI=1S/C27H29N3O5S/c1-4-33-23-15-21(16-24(17-23)34-5-2)25(31)29-27(36)30(18-19-11-13-28-14-12-19)22-9-7-20(8-10-22)26(32)35-6-3/h7-17H,4-6,18H2,1-3H3,(H,29,31,36) |
| InChIKey | ZOKDMQZIWTYODC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|