C24H24N2O4 — CID 19631305
ethyl 4-[(3-ethoxybenzoyl)-(pyridin-3-ylmethyl)amino]benzoate (PubChem CID 19631305) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl 4-[(3-ethoxybenzoyl)-(pyridin-3-ylmethyl)amino]benzoate.
| Compound Name | ethyl 4-[(3-ethoxybenzoyl)-(pyridin-3-ylmethyl)amino]benzoate |
|---|---|
| PubChem CID | 19631305 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethyl 4-[(3-ethoxybenzoyl)-(pyridin-3-ylmethyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2cccnc2)C(=O)c2cccc(OCC)c2)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-3-29-22-9-5-8-20(15-22)23(27)26(17-18-7-6-14-25-16-18)21-12-10-19(11-13-21)24(28)30-4-2/h5-16H,3-4,17H2,1-2H3 |
| InChIKey | FRPVJQZZIKTKAV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |