C25H25N3O3S — CID 22782127
ethyl 4-[(3,4-dimethylbenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate (PubChem CID 22782127) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is ethyl 4-[(3,4-dimethylbenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate.
| Compound Name | ethyl 4-[(3,4-dimethylbenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate |
|---|---|
| PubChem CID | 22782127 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | ethyl 4-[(3,4-dimethylbenzoyl)carbamothioyl-(pyridin-4-ylmethyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccncc2)C(=S)NC(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c1-4-31-24(30)20-7-9-22(10-8-20)28(16-19-11-13-26-14-12-19)25(32)27-23(29)21-6-5-17(2)18(3)15-21/h5-15H,4,16H2,1-3H3,(H,27,29,32) |
| InChIKey | WGQLNWCNQYOABT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|