C23H18Cl2N2O5 — CID 23097023
ethyl 4-[(2,4-dichlorophenyl)methyl-(2-nitrobenzoyl)amino]benzoate (PubChem CID 23097023) has the molecular formula C23H18Cl2N2O5 and a molecular weight of 473.31 g/mol. Its IUPAC name is ethyl 4-[(2,4-dichlorophenyl)methyl-(2-nitrobenzoyl)amino]benzoate.
| Compound Name | ethyl 4-[(2,4-dichlorophenyl)methyl-(2-nitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 23097023 |
| Molecular Formula | C23H18Cl2N2O5 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | ethyl 4-[(2,4-dichlorophenyl)methyl-(2-nitrobenzoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccc(Cl)cc2Cl)C(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18Cl2N2O5/c1-2-32-23(29)15-8-11-18(12-9-15)26(14-16-7-10-17(24)13-20(16)25)22(28)19-5-3-4-6-21(19)27(30)31/h3-13H,2,14H2,1H3 |
| InChIKey | RZJHNVLGFDMYQO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|