C24H20Cl2N2O6 — CID 23100359
ethyl 4-[(2,4-dichlorophenyl)methyl-[2-(4-nitrophenoxy)acetyl]amino]benzoate (PubChem CID 23100359) has the molecular formula C24H20Cl2N2O6 and a molecular weight of 503.34 g/mol. Its IUPAC name is ethyl 4-[(2,4-dichlorophenyl)methyl-[2-(4-nitrophenoxy)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[(2,4-dichlorophenyl)methyl-[2-(4-nitrophenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 23100359 |
| Molecular Formula | C24H20Cl2N2O6 |
| Molecular Weight | 503.34 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | ethyl 4-[(2,4-dichlorophenyl)methyl-[2-(4-nitrophenoxy)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccc(Cl)cc2Cl)C(=O)COc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H20Cl2N2O6/c1-2-33-24(30)16-4-7-19(8-5-16)27(14-17-3-6-18(25)13-22(17)26)23(29)15-34-21-11-9-20(10-12-21)28(31)32/h3-13H,2,14-15H2,1H3 |
| InChIKey | MLUFZMWRMJNPBL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.34 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|