C18H16Cl2N2O5 — CID 54165743
ethyl 3-[acetyl-[(2,4-dichlorophenyl)methyl]amino]-4-nitrobenzoate (PubChem CID 54165743) has the molecular formula C18H16Cl2N2O5 and a molecular weight of 411.24 g/mol. Its IUPAC name is ethyl 3-[acetyl-[(2,4-dichlorophenyl)methyl]amino]-4-nitrobenzoate.
| Compound Name | ethyl 3-[acetyl-[(2,4-dichlorophenyl)methyl]amino]-4-nitrobenzoate |
|---|---|
| PubChem CID | 54165743 |
| Molecular Formula | C18H16Cl2N2O5 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | ethyl 3-[acetyl-[(2,4-dichlorophenyl)methyl]amino]-4-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc([N+](=O)[O-])c(N(Cc2ccc(Cl)cc2Cl)C(C)=O)c1 |
| InChI | InChI=1S/C18H16Cl2N2O5/c1-3-27-18(24)12-5-7-16(22(25)26)17(8-12)21(11(2)23)10-13-4-6-14(19)9-15(13)20/h4-9H,3,10H2,1-2H3 |
| InChIKey | ORNFBTPLPMPFKE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|