C27H25N3O8S — CID 5461681
ethyl 3-benzyl-4-methyl-6-[2-(2-nitrophenyl)sulfonyloxyphenyl]-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 5461681) has the molecular formula C27H25N3O8S and a molecular weight of 551.58 g/mol. Its IUPAC name is ethyl 3-benzyl-4-methyl-6-[2-(2-nitrophenyl)sulfonyloxyphenyl]-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 3-benzyl-4-methyl-6-[2-(2-nitrophenyl)sulfonyloxyphenyl]-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 5461681 |
| Molecular Formula | C27H25N3O8S |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | ethyl 3-benzyl-4-methyl-6-[2-(2-nitrophenyl)sulfonyloxyphenyl]-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2ccccc2)C(=O)NC1c1ccccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H25N3O8S/c1-3-37-26(31)24-18(2)29(17-19-11-5-4-6-12-19)27(32)28-25(24)20-13-7-9-15-22(20)38-39(35,36)23-16-10-8-14-21(23)30(33)34/h4-16,25H,3,17H2,1-2H3,(H,28,32) |
| InChIKey | JKAYRQZBXGXLAV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|