C24H24N4O12S — CID 5461562
4-[6-[2-(2,4-dinitrophenyl)sulfonyloxyphenyl]-5-ethoxycarbonyl-4-methyl-2-oxo-1,6-dihydropyrimidin-3-yl]butanoic acid (PubChem CID 5461562) has the molecular formula C24H24N4O12S and a molecular weight of 592.54 g/mol. Its IUPAC name is 4-[6-[2-(2,4-dinitrophenyl)sulfonyloxyphenyl]-5-ethoxycarbonyl-4-methyl-2-oxo-1,6-dihydropyrimidin-3-yl]butanoic acid.
| Compound Name | 4-[6-[2-(2,4-dinitrophenyl)sulfonyloxyphenyl]-5-ethoxycarbonyl-4-methyl-2-oxo-1,6-dihydropyrimidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 5461562 |
| Molecular Formula | C24H24N4O12S |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | 4-[6-[2-(2,4-dinitrophenyl)sulfonyloxyphenyl]-5-ethoxycarbonyl-4-methyl-2-oxo-1,6-dihydropyrimidin-3-yl]butanoic acid |
| SMILES | CCOC(=O)C1=C(C)N(CCCC(=O)O)C(=O)NC1c1ccccc1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H24N4O12S/c1-3-39-23(31)21-14(2)26(12-6-9-20(29)30)24(32)25-22(21)16-7-4-5-8-18(16)40-41(37,38)19-11-10-15(27(33)34)13-17(19)28(35)36/h4-5,7-8,10-11,13,22H,3,6,9,12H2,1-2H3,(H,25,32)(H,29,30) |
| InChIKey | YWHURWCOAMNZMO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 225.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|