C18H18Br3N3O7 — CID 5461670
4-[4-methyl-6-(3-nitrophenyl)-2-oxo-5-(2,2,2-tribromoethoxycarbonyl)-1,6-dihydropyrimidin-3-yl]butanoic acid (PubChem CID 5461670) has the molecular formula C18H18Br3N3O7 and a molecular weight of 628.07 g/mol. Its IUPAC name is 4-[4-methyl-6-(3-nitrophenyl)-2-oxo-5-(2,2,2-tribromoethoxycarbonyl)-1,6-dihydropyrimidin-3-yl]butanoic acid.
| Compound Name | 4-[4-methyl-6-(3-nitrophenyl)-2-oxo-5-(2,2,2-tribromoethoxycarbonyl)-1,6-dihydropyrimidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 5461670 |
| Molecular Formula | C18H18Br3N3O7 |
| Molecular Weight | 628.07 g/mol |
| Exact Mass | 624.87 |
| IUPAC Name | 4-[4-methyl-6-(3-nitrophenyl)-2-oxo-5-(2,2,2-tribromoethoxycarbonyl)-1,6-dihydropyrimidin-3-yl]butanoic acid |
| SMILES | CC1=C(C(=O)OCC(Br)(Br)Br)C(c2cccc([N+](=O)[O-])c2)NC(=O)N1CCCC(=O)O |
| InChI | InChI=1S/C18H18Br3N3O7/c1-10-14(16(27)31-9-18(19,20)21)15(11-4-2-5-12(8-11)24(29)30)22-17(28)23(10)7-3-6-13(25)26/h2,4-5,8,15H,3,6-7,9H2,1H3,(H,22,28)(H,25,26) |
| InChIKey | MNFRVPPMNJKMNY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.07 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|