C21H19F2N3O5 — CID 55834060
ethyl 3-benzyl-6-(2,4-difluoro-5-nitrophenyl)-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 55834060) has the molecular formula C21H19F2N3O5 and a molecular weight of 431.40 g/mol. Its IUPAC name is ethyl 3-benzyl-6-(2,4-difluoro-5-nitrophenyl)-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 3-benzyl-6-(2,4-difluoro-5-nitrophenyl)-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 55834060 |
| Molecular Formula | C21H19F2N3O5 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | ethyl 3-benzyl-6-(2,4-difluoro-5-nitrophenyl)-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2ccccc2)C(=O)NC1c1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C21H19F2N3O5/c1-3-31-20(27)18-12(2)25(11-13-7-5-4-6-8-13)21(28)24-19(18)14-9-17(26(29)30)16(23)10-15(14)22/h4-10,19H,3,11H2,1-2H3,(H,24,28) |
| InChIKey | HUNWYPGHCSXXSQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|