C19H17F2N3O5S — CID 55834191
ethyl 6-(2,4-difluoro-5-nitrophenyl)-4-methyl-2-oxo-3-(thiophen-2-ylmethyl)-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 55834191) has the molecular formula C19H17F2N3O5S and a molecular weight of 437.42 g/mol. Its IUPAC name is ethyl 6-(2,4-difluoro-5-nitrophenyl)-4-methyl-2-oxo-3-(thiophen-2-ylmethyl)-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-(2,4-difluoro-5-nitrophenyl)-4-methyl-2-oxo-3-(thiophen-2-ylmethyl)-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 55834191 |
| Molecular Formula | C19H17F2N3O5S |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | ethyl 6-(2,4-difluoro-5-nitrophenyl)-4-methyl-2-oxo-3-(thiophen-2-ylmethyl)-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2cccs2)C(=O)NC1c1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C19H17F2N3O5S/c1-3-29-18(25)16-10(2)23(9-11-5-4-6-30-11)19(26)22-17(16)12-7-15(24(27)28)14(21)8-13(12)20/h4-8,17H,3,9H2,1-2H3,(H,22,26) |
| InChIKey | CMWLCPCLVYXEBH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|