C11H10F3NO3 — CID 177399806
1-methoxy-4-[(1S,2S,3S)-2-nitro-3-(trifluoromethyl)cyclopropyl]benzene (PubChem CID 177399806) has the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. Its IUPAC name is 1-methoxy-4-[(1S,2S,3S)-2-nitro-3-(trifluoromethyl)cyclopropyl]benzene.
| Compound Name | 1-methoxy-4-[(1S,2S,3S)-2-nitro-3-(trifluoromethyl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 177399806 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-methoxy-4-[(1S,2S,3S)-2-nitro-3-(trifluoromethyl)cyclopropyl]benzene |
| SMILES | COc1ccc([C@H]2[C@H]([N+](=O)[O-])[C@H]2C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3NO3/c1-18-7-4-2-6(3-5-7)8-9(11(12,13)14)10(8)15(16)17/h2-5,8-10H,1H3/t8-,9+,10+/m1/s1 |
| InChIKey | LVZJLVONMPQUMQ-UTLUCORTSA-N |
| XLogP | 2.62 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|