C32H35FN2O9 — CID 177419476
tert-butyl (1R,2R,3R,4S,5R,6S)-2-[(4-fluorophenyl)methyl]-1-hydroxy-3,5-bis(4-methoxyphenyl)-4,6-dinitrocyclohexane-1-carboxylate (PubChem CID 177419476) has the molecular formula C32H35FN2O9 and a molecular weight of 610.64 g/mol. Its IUPAC name is tert-butyl (1R,2R,3R,4S,5R,6S)-2-[(4-fluorophenyl)methyl]-1-hydroxy-3,5-bis(4-methoxyphenyl)-4,6-dinitrocyclohexane-1-carboxylate.
| Compound Name | tert-butyl (1R,2R,3R,4S,5R,6S)-2-[(4-fluorophenyl)methyl]-1-hydroxy-3,5-bis(4-methoxyphenyl)-4,6-dinitrocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 177419476 |
| Molecular Formula | C32H35FN2O9 |
| Molecular Weight | 610.64 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | tert-butyl (1R,2R,3R,4S,5R,6S)-2-[(4-fluorophenyl)methyl]-1-hydroxy-3,5-bis(4-methoxyphenyl)-4,6-dinitrocyclohexane-1-carboxylate |
| SMILES | COc1ccc([C@@H]2[C@H]([N+](=O)[O-])[C@@H](c3ccc(OC)cc3)[C@H]([N+](=O)[O-])[C@@](O)(C(=O)OC(C)(C)C)[C@@H]2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C32H35FN2O9/c1-31(2,3)44-30(36)32(37)25(18-19-6-12-22(33)13-7-19)26(20-8-14-23(42-4)15-9-20)28(34(38)39)27(29(32)35(40)41)21-10-16-24(43-5)17-11-21/h6-17,25-29,37H,18H2,1-5H3/t25-,26+,27-,28+,29+,32-/m1/s1 |
| InChIKey | VXQBDZUYPQKHOY-SALYQJGLSA-N |
| XLogP | 4.95 |
| TPSA | 151.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|