C23H19N5O4 — CID 102392328
(4S,5S,6S)-2-amino-4,6-bis(4-methoxyphenyl)-5-nitrocyclohex-2-ene-1,1,3-tricarbonitrile (PubChem CID 102392328) has the molecular formula C23H19N5O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is (4S,5S,6S)-2-amino-4,6-bis(4-methoxyphenyl)-5-nitrocyclohex-2-ene-1,1,3-tricarbonitrile.
| Compound Name | (4S,5S,6S)-2-amino-4,6-bis(4-methoxyphenyl)-5-nitrocyclohex-2-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 102392328 |
| Molecular Formula | C23H19N5O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (4S,5S,6S)-2-amino-4,6-bis(4-methoxyphenyl)-5-nitrocyclohex-2-ene-1,1,3-tricarbonitrile |
| SMILES | COc1ccc([C@H]2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3ccc(OC)cc3)[C@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19N5O4/c1-31-16-7-3-14(4-8-16)19-18(11-24)22(27)23(12-25,13-26)20(21(19)28(29)30)15-5-9-17(32-2)10-6-15/h3-10,19-21H,27H2,1-2H3/t19-,20+,21-/m0/s1 |
| InChIKey | JGNVHGQLKVWGPC-HBMCJLEFSA-N |
| XLogP | 3.00 |
| TPSA | 158.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|