C26H22N4O — CID 92846524
(4S,4aR,6S)-2-amino-4-(4-methoxyphenyl)-6-phenyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 92846524) has the molecular formula C26H22N4O and a molecular weight of 406.49 g/mol. Its IUPAC name is (4S,4aR,6S)-2-amino-4-(4-methoxyphenyl)-6-phenyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4S,4aR,6S)-2-amino-4-(4-methoxyphenyl)-6-phenyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 92846524 |
| Molecular Formula | C26H22N4O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (4S,4aR,6S)-2-amino-4-(4-methoxyphenyl)-6-phenyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | COc1ccc([C@@H]2[C@H]3C[C@@H](c4ccccc4)CC=C3C(C#N)=C(N)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C26H22N4O/c1-31-20-10-7-18(8-11-20)24-22-13-19(17-5-3-2-4-6-17)9-12-21(22)23(14-27)25(30)26(24,15-28)16-29/h2-8,10-12,19,22,24H,9,13,30H2,1H3/t19-,22-,24+/m0/s1 |
| InChIKey | HIMCHXQWQSFCCM-NGYIFUPDSA-N |
| XLogP | 4.68 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|