C23H24N4O2 — CID 11838491
(4R,4aR)-2-amino-4-(2,5-dimethoxyphenyl)-6-ethyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 11838491) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (4R,4aR)-2-amino-4-(2,5-dimethoxyphenyl)-6-ethyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4R,4aR)-2-amino-4-(2,5-dimethoxyphenyl)-6-ethyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 11838491 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (4R,4aR)-2-amino-4-(2,5-dimethoxyphenyl)-6-ethyl-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | CCC1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3cc(OC)ccc3OC)[C@H]2C1 |
| InChI | InChI=1S/C23H24N4O2/c1-4-14-5-7-16-17(9-14)21(18-10-15(28-2)6-8-20(18)29-3)23(12-25,13-26)22(27)19(16)11-24/h6-8,10,14,17,21H,4-5,9,27H2,1-3H3/t14?,17-,21-/m0/s1 |
| InChIKey | MMCLSZOTVXTBKG-FKQPOWTQSA-N |
| XLogP | 3.93 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|