C22H21N5O — CID 57149819
(1S,2R,3R,9R)-5-amino-3-(4-methoxyphenyl)-12-methyl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile (PubChem CID 57149819) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is (1S,2R,3R,9R)-5-amino-3-(4-methoxyphenyl)-12-methyl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile.
| Compound Name | (1S,2R,3R,9R)-5-amino-3-(4-methoxyphenyl)-12-methyl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile |
|---|---|
| PubChem CID | 57149819 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (1S,2R,3R,9R)-5-amino-3-(4-methoxyphenyl)-12-methyl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile |
| SMILES | COc1ccc([C@H]2[C@@H]3C(=C[C@H]4CC[C@@H]3N4C)C(C#N)=C(N)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C22H21N5O/c1-27-14-5-8-18(27)19-16(9-14)17(10-23)21(26)22(11-24,12-25)20(19)13-3-6-15(28-2)7-4-13/h3-4,6-7,9,14,18-20H,5,8,26H2,1-2H3/t14-,18+,19-,20+/m1/s1 |
| InChIKey | QAWCSHGMVQKVTE-YGBSJELFSA-N |
| XLogP | 2.58 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|