C21H17Cl2N5 — CID 51555746
(1R,2R,3S,9S)-5-amino-3-(3,4-dichlorophenyl)-12-methyl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile (PubChem CID 51555746) has the molecular formula C21H17Cl2N5 and a molecular weight of 410.31 g/mol. Its IUPAC name is (1R,2R,3S,9S)-5-amino-3-(3,4-dichlorophenyl)-12-methyl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile.
| Compound Name | (1R,2R,3S,9S)-5-amino-3-(3,4-dichlorophenyl)-12-methyl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile |
|---|---|
| PubChem CID | 51555746 |
| Molecular Formula | C21H17Cl2N5 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (1R,2R,3S,9S)-5-amino-3-(3,4-dichlorophenyl)-12-methyl-12-azatricyclo[7.2.1.02,7]dodeca-5,7-diene-4,4,6-tricarbonitrile |
| SMILES | CN1[C@@H]2C=C3C(C#N)=C(N)C(C#N)(C#N)[C@H](c4ccc(Cl)c(Cl)c4)[C@H]3[C@H]1CC2 |
| InChI | InChI=1S/C21H17Cl2N5/c1-28-12-3-5-17(28)18-13(7-12)14(8-24)20(27)21(9-25,10-26)19(18)11-2-4-15(22)16(23)6-11/h2,4,6-7,12,17-19H,3,5,27H2,1H3/t12-,17+,18+,19+/m0/s1 |
| InChIKey | CRZZFQSJDRYLJT-VEFTVXKRSA-N |
| XLogP | 3.88 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|