C21H17Cl2N5 — CID 11898435
(1R,2S,3R,9S)-3-(3,4-dichlorophenyl)-5-imino-12-methyl-12-azatricyclo[7.2.1.02,7]dodec-7-ene-4,4,6-tricarbonitrile (PubChem CID 11898435) has the molecular formula C21H17Cl2N5 and a molecular weight of 410.31 g/mol. Its IUPAC name is (1R,2S,3R,9S)-3-(3,4-dichlorophenyl)-5-imino-12-methyl-12-azatricyclo[7.2.1.02,7]dodec-7-ene-4,4,6-tricarbonitrile.
| Compound Name | (1R,2S,3R,9S)-3-(3,4-dichlorophenyl)-5-imino-12-methyl-12-azatricyclo[7.2.1.02,7]dodec-7-ene-4,4,6-tricarbonitrile |
|---|---|
| PubChem CID | 11898435 |
| Molecular Formula | C21H17Cl2N5 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (1R,2S,3R,9S)-3-(3,4-dichlorophenyl)-5-imino-12-methyl-12-azatricyclo[7.2.1.02,7]dodec-7-ene-4,4,6-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=C[C@@H]3CC[C@H]([C@H]2[C@H](c2ccc(Cl)c(Cl)c2)C1(C#N)C#N)N3C |
| InChI | InChI=1S/C21H17Cl2N5/c1-28-12-3-5-17(28)18-13(7-12)14(8-24)20(27)21(9-25,10-26)19(18)11-2-4-15(22)16(23)6-11/h2,4,6-7,12,14,17-19,27H,3,5H2,1H3/b27-20+/t12-,14?,17+,18-,19-/m0/s1 |
| InChIKey | CXIUHSNEEKANJL-UALJSELKSA-N |
| XLogP | 4.30 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|