C24H28N5+ — CID 11878202
(5R,8R,8aS)-6-imino-2-propan-2-yl-8-(4-propan-2-ylphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 11878202) has the molecular formula C24H28N5+ and a molecular weight of 386.52 g/mol. Its IUPAC name is (5R,8R,8aS)-6-imino-2-propan-2-yl-8-(4-propan-2-ylphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (5R,8R,8aS)-6-imino-2-propan-2-yl-8-(4-propan-2-ylphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11878202 |
| Molecular Formula | C24H28N5+ |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (5R,8R,8aS)-6-imino-2-propan-2-yl-8-(4-propan-2-ylphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)C2=CC[NH+](C(C)C)C[C@H]2[C@H](c2ccc(C(C)C)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C24H27N5/c1-15(2)17-5-7-18(8-6-17)22-21-12-29(16(3)4)10-9-19(21)20(11-25)23(28)24(22,13-26)14-27/h5-9,15-16,20-22,28H,10,12H2,1-4H3/p+1/b28-23+/t20-,21-,22+/m1/s1 |
| InChIKey | ZWQJHSIKKKBZCV-FSSZOAJQSA-O |
| XLogP | 2.95 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|