C20H18N5O2+ — CID 11895395
(8S,8aR)-8-(1,3-benzodioxol-5-yl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 11895395) has the molecular formula C20H18N5O2+ and a molecular weight of 360.40 g/mol. Its IUPAC name is (8S,8aR)-8-(1,3-benzodioxol-5-yl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aR)-8-(1,3-benzodioxol-5-yl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11895395 |
| Molecular Formula | C20H18N5O2+ |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (8S,8aR)-8-(1,3-benzodioxol-5-yl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](C)C[C@@H]2[C@@H](c2ccc3c(c2)OCO3)C1(C#N)C#N |
| InChI | InChI=1S/C20H17N5O2/c1-25-5-4-13-14(7-21)19(24)20(9-22,10-23)18(15(13)8-25)12-2-3-16-17(6-12)27-11-26-16/h2-4,6,14-15,18,24H,5,8,11H2,1H3/p+1/b24-19+/t14?,15-,18+/m0/s1 |
| InChIKey | FBNQZPCIXYEKNX-QOGCVGKBSA-O |
| XLogP | 0.78 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|