C21H22N5+ — CID 7099502
(8S,8aS)-6-imino-2-methyl-8-(2-phenylethyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 7099502) has the molecular formula C21H22N5+ and a molecular weight of 344.44 g/mol. Its IUPAC name is (8S,8aS)-6-imino-2-methyl-8-(2-phenylethyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aS)-6-imino-2-methyl-8-(2-phenylethyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7099502 |
| Molecular Formula | C21H22N5+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (8S,8aS)-6-imino-2-methyl-8-(2-phenylethyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](C)C[C@H]2[C@H](CCc2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H21N5/c1-26-10-9-16-17(11-22)20(25)21(13-23,14-24)19(18(16)12-26)8-7-15-5-3-2-4-6-15/h2-6,9,17-19,25H,7-8,10,12H2,1H3/p+1/b25-20+/t17?,18-,19+/m1/s1 |
| InChIKey | WLIACZUBCTWURB-JKKGRPLNSA-O |
| XLogP | 1.51 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|