C21H19N5O — CID 6964977
(8S,8aS)-2-acetyl-8-benzyl-6-imino-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile (PubChem CID 6964977) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is (8S,8aS)-2-acetyl-8-benzyl-6-imino-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aS)-2-acetyl-8-benzyl-6-imino-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 6964977 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (8S,8aS)-2-acetyl-8-benzyl-6-imino-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CCN(C(C)=O)C[C@H]2[C@H](Cc2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H19N5O/c1-14(27)26-8-7-16-17(10-22)20(25)21(12-23,13-24)19(18(16)11-26)9-15-5-3-2-4-6-15/h2-7,17-19,25H,8-9,11H2,1H3/b25-20+/t17?,18-,19+/m1/s1 |
| InChIKey | KFGUFMMZRTYSJE-JKKGRPLNSA-N |
| XLogP | 2.46 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|