C23H25N5 — CID 11903620
(5S,8R,8aR)-2-benzyl-6-imino-8-(2-methylpropyl)-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile (PubChem CID 11903620) has the molecular formula C23H25N5 and a molecular weight of 371.49 g/mol. Its IUPAC name is (5S,8R,8aR)-2-benzyl-6-imino-8-(2-methylpropyl)-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (5S,8R,8aR)-2-benzyl-6-imino-8-(2-methylpropyl)-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11903620 |
| Molecular Formula | C23H25N5 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (5S,8R,8aR)-2-benzyl-6-imino-8-(2-methylpropyl)-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCN(Cc3ccccc3)C[C@@H]2[C@@H](CC(C)C)C1(C#N)C#N |
| InChI | InChI=1S/C23H25N5/c1-16(2)10-21-20-13-28(12-17-6-4-3-5-7-17)9-8-18(20)19(11-24)22(27)23(21,14-25)15-26/h3-8,16,19-21,27H,9-10,12-13H2,1-2H3/b27-22+/t19-,20-,21+/m0/s1 |
| InChIKey | QIVXVYOUTTUJBV-MNMFRKSOSA-N |
| XLogP | 3.91 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|