C21H19N5O2 — CID 11878431
[4-[(5R,8S,8aR)-5,7,7-tricyano-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]phenyl] acetate (PubChem CID 11878431) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is [4-[(5R,8S,8aR)-5,7,7-tricyano-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]phenyl] acetate.
| Compound Name | [4-[(5R,8S,8aR)-5,7,7-tricyano-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]phenyl] acetate |
|---|---|
| PubChem CID | 11878431 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [4-[(5R,8S,8aR)-5,7,7-tricyano-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]phenyl] acetate |
| SMILES | [H]/N=C1\[C@H](C#N)C2=CCN(C)C[C@@H]2[C@@H](c2ccc(OC(C)=O)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H19N5O2/c1-13(27)28-15-5-3-14(4-6-15)19-18-10-26(2)8-7-16(18)17(9-22)20(25)21(19,11-23)12-24/h3-7,17-19,25H,8,10H2,1-2H3/b25-20+/t17-,18+,19-/m1/s1 |
| InChIKey | GDNNNAKOAGZZNA-DPAFLUFQSA-N |
| XLogP | 2.39 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|