C21H19N5O2 — CID 7307226
methyl 4-[(8S,8aS)-5,7,7-tricyano-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate (PubChem CID 7307226) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is methyl 4-[(8S,8aS)-5,7,7-tricyano-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate.
| Compound Name | methyl 4-[(8S,8aS)-5,7,7-tricyano-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate |
|---|---|
| PubChem CID | 7307226 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | methyl 4-[(8S,8aS)-5,7,7-tricyano-6-imino-2-methyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]benzoate |
| SMILES | [H]/N=C1\C(C#N)C2=CCN(C)C[C@H]2[C@@H](c2ccc(C(=O)OC)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H19N5O2/c1-26-8-7-15-16(9-22)19(25)21(11-23,12-24)18(17(15)10-26)13-3-5-14(6-4-13)20(27)28-2/h3-7,16-18,25H,8,10H2,1-2H3/b25-19+/t16?,17-,18-/m1/s1 |
| InChIKey | XMSMWLHEJHDECV-OADPKVNKSA-N |
| XLogP | 2.25 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|