C23H24N6O2 — CID 7236521
2-[4-[(8R,8aS)-5,7,7-tricyano-6-imino-2-propyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]phenoxy]acetamide (PubChem CID 7236521) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-[4-[(8R,8aS)-5,7,7-tricyano-6-imino-2-propyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[(8R,8aS)-5,7,7-tricyano-6-imino-2-propyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 7236521 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-[4-[(8R,8aS)-5,7,7-tricyano-6-imino-2-propyl-3,5,8,8a-tetrahydro-1H-isoquinolin-8-yl]phenoxy]acetamide |
| SMILES | [H]/N=C1\C(C#N)C2=CCN(CCC)C[C@H]2[C@H](c2ccc(OCC(N)=O)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C23H24N6O2/c1-2-8-29-9-7-17-18(10-24)22(28)23(13-25,14-26)21(19(17)11-29)15-3-5-16(6-4-15)31-12-20(27)30/h3-7,18-19,21,28H,2,8-9,11-12H2,1H3,(H2,27,30)/b28-22+/t18?,19-,21+/m1/s1 |
| InChIKey | SQDWJCCQQDJNQZ-CSESCQDGSA-N |
| XLogP | 2.11 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|