C20H18N6O2 — CID 7307228
2-[4-[(5S,8S,8aR)-5,7,7-tricyano-6-imino-1,2,3,5,8,8a-hexahydroisoquinolin-8-yl]phenoxy]acetamide (PubChem CID 7307228) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[4-[(5S,8S,8aR)-5,7,7-tricyano-6-imino-1,2,3,5,8,8a-hexahydroisoquinolin-8-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[(5S,8S,8aR)-5,7,7-tricyano-6-imino-1,2,3,5,8,8a-hexahydroisoquinolin-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 7307228 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[4-[(5S,8S,8aR)-5,7,7-tricyano-6-imino-1,2,3,5,8,8a-hexahydroisoquinolin-8-yl]phenoxy]acetamide |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCNC[C@@H]2[C@@H](c2ccc(OCC(N)=O)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C20H18N6O2/c21-7-15-14-5-6-26-8-16(14)18(20(10-22,11-23)19(15)25)12-1-3-13(4-2-12)28-9-17(24)27/h1-5,15-16,18,25-26H,6,8-9H2,(H2,24,27)/b25-19+/t15-,16-,18+/m0/s1 |
| InChIKey | CHUHEGLNMKSMIR-NPIFKOQBSA-N |
| XLogP | 0.99 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|