C18H13FN4O — CID 11891698
(5R,8R,8aS)-8-(4-fluorophenyl)-6-imino-3,5,8,8a-tetrahydro-1H-isochromene-5,7,7-tricarbonitrile (PubChem CID 11891698) has the molecular formula C18H13FN4O and a molecular weight of 320.33 g/mol. Its IUPAC name is (5R,8R,8aS)-8-(4-fluorophenyl)-6-imino-3,5,8,8a-tetrahydro-1H-isochromene-5,7,7-tricarbonitrile.
| Compound Name | (5R,8R,8aS)-8-(4-fluorophenyl)-6-imino-3,5,8,8a-tetrahydro-1H-isochromene-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11891698 |
| Molecular Formula | C18H13FN4O |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (5R,8R,8aS)-8-(4-fluorophenyl)-6-imino-3,5,8,8a-tetrahydro-1H-isochromene-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)C2=CCOC[C@H]2[C@H](c2ccc(F)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C18H13FN4O/c19-12-3-1-11(2-4-12)16-15-8-24-6-5-13(15)14(7-20)17(23)18(16,9-21)10-22/h1-5,14-16,23H,6,8H2/b23-17+/t14-,15-,16+/m1/s1 |
| InChIKey | ZIVKYRZRKHBXKC-WWWIBDCFSA-N |
| XLogP | 2.69 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|