C18H13FN4S — CID 11859177
(5S,8S,8aR)-8-(4-fluorophenyl)-6-imino-3,5,8,8a-tetrahydro-1H-isothiochromene-5,7,7-tricarbonitrile (PubChem CID 11859177) has the molecular formula C18H13FN4S and a molecular weight of 336.40 g/mol. Its IUPAC name is (5S,8S,8aR)-8-(4-fluorophenyl)-6-imino-3,5,8,8a-tetrahydro-1H-isothiochromene-5,7,7-tricarbonitrile.
| Compound Name | (5S,8S,8aR)-8-(4-fluorophenyl)-6-imino-3,5,8,8a-tetrahydro-1H-isothiochromene-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11859177 |
| Molecular Formula | C18H13FN4S |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (5S,8S,8aR)-8-(4-fluorophenyl)-6-imino-3,5,8,8a-tetrahydro-1H-isothiochromene-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCSC[C@@H]2[C@@H](c2ccc(F)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C18H13FN4S/c19-12-3-1-11(2-4-12)16-15-8-24-6-5-13(15)14(7-20)17(23)18(16,9-21)10-22/h1-5,14-16,23H,6,8H2/b23-17+/t14-,15-,16+/m0/s1 |
| InChIKey | SRQAKDIRVGERRJ-AXZJICENSA-N |
| XLogP | 3.41 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|