C21H19F3N5+ — CID 7336521
(8S,8aS)-2-ethyl-6-imino-8-[4-(trifluoromethyl)phenyl]-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 7336521) has the molecular formula C21H19F3N5+ and a molecular weight of 398.41 g/mol. Its IUPAC name is (8S,8aS)-2-ethyl-6-imino-8-[4-(trifluoromethyl)phenyl]-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aS)-2-ethyl-6-imino-8-[4-(trifluoromethyl)phenyl]-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7336521 |
| Molecular Formula | C21H19F3N5+ |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (8S,8aS)-2-ethyl-6-imino-8-[4-(trifluoromethyl)phenyl]-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](CC)C[C@H]2[C@@H](c2ccc(C(F)(F)F)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H18F3N5/c1-2-29-8-7-15-16(9-25)19(28)20(11-26,12-27)18(17(15)10-29)13-3-5-14(6-4-13)21(22,23)24/h3-7,16-18,28H,2,8,10H2,1H3/p+1/b28-19+/t16?,17-,18-/m1/s1 |
| InChIKey | GGNNOZWLVYVDMW-FFSZCSGRSA-O |
| XLogP | 2.46 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|