C23H26N5+ — CID 7236564
(8R,8aS)-2-ethyl-6-imino-8-(4-propan-2-ylphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 7236564) has the molecular formula C23H26N5+ and a molecular weight of 372.50 g/mol. Its IUPAC name is (8R,8aS)-2-ethyl-6-imino-8-(4-propan-2-ylphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aS)-2-ethyl-6-imino-8-(4-propan-2-ylphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7236564 |
| Molecular Formula | C23H26N5+ |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (8R,8aS)-2-ethyl-6-imino-8-(4-propan-2-ylphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](CC)C[C@H]2[C@H](c2ccc(C(C)C)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C23H25N5/c1-4-28-10-9-18-19(11-24)22(27)23(13-25,14-26)21(20(18)12-28)17-7-5-16(6-8-17)15(2)3/h5-9,15,19-21,27H,4,10,12H2,1-3H3/p+1/b27-22+/t19?,20-,21+/m1/s1 |
| InChIKey | JPJKBHHPUQHSBV-WWCCHOHVSA-O |
| XLogP | 2.56 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|