C21H21N6O2+ — CID 11878414
(8R,8aS)-6-imino-8-(4-nitrophenyl)-2-propyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 11878414) has the molecular formula C21H21N6O2+ and a molecular weight of 389.44 g/mol. Its IUPAC name is (8R,8aS)-6-imino-8-(4-nitrophenyl)-2-propyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aS)-6-imino-8-(4-nitrophenyl)-2-propyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11878414 |
| Molecular Formula | C21H21N6O2+ |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (8R,8aS)-6-imino-8-(4-nitrophenyl)-2-propyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](CCC)C[C@H]2[C@H](c2ccc([N+](=O)[O-])cc2)C1(C#N)C#N |
| InChI | InChI=1S/C21H20N6O2/c1-2-8-26-9-7-16-17(10-22)20(25)21(12-23,13-24)19(18(16)11-26)14-3-5-15(6-4-14)27(28)29/h3-7,17-19,25H,2,8-9,11H2,1H3/p+1/b25-20+/t17?,18-,19+/m1/s1 |
| InChIKey | CRYWZYFTQLVODW-JKKGRPLNSA-O |
| XLogP | 1.74 |
| TPSA | 142.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|