C23H25N6O2+ — CID 11895399
2-[4-[(8S,8aR)-5,7,7-tricyano-6-imino-2-propyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-8-yl]phenoxy]acetamide (PubChem CID 11895399) has the molecular formula C23H25N6O2+ and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[4-[(8S,8aR)-5,7,7-tricyano-6-imino-2-propyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-8-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[(8S,8aR)-5,7,7-tricyano-6-imino-2-propyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 11895399 |
| Molecular Formula | C23H25N6O2+ |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-[4-[(8S,8aR)-5,7,7-tricyano-6-imino-2-propyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-8-yl]phenoxy]acetamide |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](CCC)C[C@@H]2[C@@H](c2ccc(OCC(N)=O)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C23H24N6O2/c1-2-8-29-9-7-17-18(10-24)22(28)23(13-25,14-26)21(19(17)11-29)15-3-5-16(6-4-15)31-12-20(27)30/h3-7,18-19,21,28H,2,8-9,11-12H2,1H3,(H2,27,30)/p+1/b28-22+/t18?,19-,21+/m0/s1 |
| InChIKey | SQDWJCCQQDJNQZ-NCZLGVMKSA-O |
| XLogP | 0.69 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|