C22H23N6O3+ — CID 7182729
2-[4-[(8R,8aR)-5,7,7-tricyano-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-8-yl]-2-methoxyphenoxy]acetamide (PubChem CID 7182729) has the molecular formula C22H23N6O3+ and a molecular weight of 419.47 g/mol. Its IUPAC name is 2-[4-[(8R,8aR)-5,7,7-tricyano-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-8-yl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(8R,8aR)-5,7,7-tricyano-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-8-yl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 7182729 |
| Molecular Formula | C22H23N6O3+ |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[4-[(8R,8aR)-5,7,7-tricyano-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-8-yl]-2-methoxyphenoxy]acetamide |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](C)C[C@@H]2[C@H](c2ccc(OCC(N)=O)c(OC)c2)C1(C#N)C#N |
| InChI | InChI=1S/C22H22N6O3/c1-28-6-5-14-15(8-23)21(27)22(11-24,12-25)20(16(14)9-28)13-3-4-17(18(7-13)30-2)31-10-19(26)29/h3-5,7,15-16,20,27H,6,9-10H2,1-2H3,(H2,26,29)/p+1/b27-21+/t15?,16-,20-/m0/s1 |
| InChIKey | VEDKQJIHHMVSDO-VNOFZWJNSA-O |
| XLogP | -0.08 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|