C19H17FN5+ — CID 7236481
(8S,8aR)-8-(2-fluorophenyl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 7236481) has the molecular formula C19H17FN5+ and a molecular weight of 334.38 g/mol. Its IUPAC name is (8S,8aR)-8-(2-fluorophenyl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aR)-8-(2-fluorophenyl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7236481 |
| Molecular Formula | C19H17FN5+ |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (8S,8aR)-8-(2-fluorophenyl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](C)C[C@@H]2[C@H](c2ccccc2F)C1(C#N)C#N |
| InChI | InChI=1S/C19H16FN5/c1-25-7-6-12-14(8-21)18(24)19(10-22,11-23)17(15(12)9-25)13-4-2-3-5-16(13)20/h2-6,14-15,17,24H,7,9H2,1H3/p+1/b24-18+/t14?,15-,17-/m0/s1 |
| InChIKey | FCJYMLALZQJQDE-QNIWTLETSA-O |
| XLogP | 1.19 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|