C21H22N5O2+ — CID 7219530
(8R,8aS)-8-(3,4-dimethoxyphenyl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 7219530) has the molecular formula C21H22N5O2+ and a molecular weight of 376.44 g/mol. Its IUPAC name is (8R,8aS)-8-(3,4-dimethoxyphenyl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aS)-8-(3,4-dimethoxyphenyl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7219530 |
| Molecular Formula | C21H22N5O2+ |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (8R,8aS)-8-(3,4-dimethoxyphenyl)-6-imino-2-methyl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](C)C[C@H]2[C@H](c2ccc(OC)c(OC)c2)C1(C#N)C#N |
| InChI | InChI=1S/C21H21N5O2/c1-26-7-6-14-15(9-22)20(25)21(11-23,12-24)19(16(14)10-26)13-4-5-17(27-2)18(8-13)28-3/h4-6,8,15-16,19,25H,7,10H2,1-3H3/p+1/b25-20+/t15?,16-,19+/m1/s1 |
| InChIKey | VFGIRUVFMVSZFD-CCWXUUBBSA-O |
| XLogP | 1.07 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|