C24H28N5O2+ — CID 11891703
(5R,8R,8aR)-2-ethyl-6-imino-8-(3-methoxy-4-propoxyphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 11891703) has the molecular formula C24H28N5O2+ and a molecular weight of 418.52 g/mol. Its IUPAC name is (5R,8R,8aR)-2-ethyl-6-imino-8-(3-methoxy-4-propoxyphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (5R,8R,8aR)-2-ethyl-6-imino-8-(3-methoxy-4-propoxyphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11891703 |
| Molecular Formula | C24H28N5O2+ |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (5R,8R,8aR)-2-ethyl-6-imino-8-(3-methoxy-4-propoxyphenyl)-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)C2=CC[NH+](CC)C[C@@H]2[C@H](c2ccc(OCCC)c(OC)c2)C1(C#N)C#N |
| InChI | InChI=1S/C24H27N5O2/c1-4-10-31-20-7-6-16(11-21(20)30-3)22-19-13-29(5-2)9-8-17(19)18(12-25)23(28)24(22,14-26)15-27/h6-8,11,18-19,22,28H,4-5,9-10,13H2,1-3H3/p+1/b28-23+/t18-,19+,22+/m1/s1 |
| InChIKey | XNLVFSAINFOVEG-SQTAMORJSA-O |
| XLogP | 2.24 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|