C19H19N6+ — CID 7307732
(8R,8aR)-2-ethyl-6-imino-8-pyridin-3-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile (PubChem CID 7307732) has the molecular formula C19H19N6+ and a molecular weight of 331.40 g/mol. Its IUPAC name is (8R,8aR)-2-ethyl-6-imino-8-pyridin-3-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-2-ethyl-6-imino-8-pyridin-3-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7307732 |
| Molecular Formula | C19H19N6+ |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (8R,8aR)-2-ethyl-6-imino-8-pyridin-3-yl-1,2,3,5,8,8a-hexahydroisoquinolin-2-ium-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](CC)C[C@@H]2[C@H](c2cccnc2)C1(C#N)C#N |
| InChI | InChI=1S/C19H18N6/c1-2-25-7-5-14-15(8-20)18(23)19(11-21,12-22)17(16(14)10-25)13-4-3-6-24-9-13/h3-6,9,15-17,23H,2,7,10H2,1H3/p+1/b23-18+/t15?,16-,17-/m0/s1 |
| InChIKey | GSEOZCORTAPRFX-GTZCKQOSSA-O |
| XLogP | 0.83 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|