C18H15N5 — CID 73129400
2-imino-4-pyridin-4-yl-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile (PubChem CID 73129400) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-imino-4-pyridin-4-yl-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile.
| Compound Name | 2-imino-4-pyridin-4-yl-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 73129400 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-imino-4-pyridin-4-yl-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CCCCC2C(c2ccncc2)C1(C#N)C#N |
| InChI | InChI=1S/C18H15N5/c19-9-15-13-3-1-2-4-14(13)16(12-5-7-23-8-6-12)18(10-20,11-21)17(15)22/h3,5-8,14-16,22H,1-2,4H2/b22-17+ |
| InChIKey | GFDVZZSFELGAGY-OQKWZONESA-N |
| XLogP | 3.10 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|