C20H20N6 — CID 7237401
(8R,8aR)-6-imino-2-propyl-8-pyridin-4-yl-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile (PubChem CID 7237401) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is (8R,8aR)-6-imino-2-propyl-8-pyridin-4-yl-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aR)-6-imino-2-propyl-8-pyridin-4-yl-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 7237401 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (8R,8aR)-6-imino-2-propyl-8-pyridin-4-yl-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CCN(CCC)C[C@@H]2[C@H](c2ccncc2)C1(C#N)C#N |
| InChI | InChI=1S/C20H20N6/c1-2-8-26-9-5-15-16(10-21)19(24)20(12-22,13-23)18(17(15)11-26)14-3-6-25-7-4-14/h3-7,16-18,24H,2,8-9,11H2,1H3/b24-19+/t16?,17-,18-/m0/s1 |
| InChIKey | KZBWONJBUXSQLJ-BAHPTYCJSA-N |
| XLogP | 2.64 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|