C20H18N5O2S+ — CID 7307291
[(5R,8R,8aR)-8-[3-(2-amino-2-oxoethoxy)phenyl]-5,7,7-tricyano-3,5,8,8a-tetrahydro-1H-isothiochromen-6-ylidene]azanium (PubChem CID 7307291) has the molecular formula C20H18N5O2S+ and a molecular weight of 392.46 g/mol. Its IUPAC name is [(5R,8R,8aR)-8-[3-(2-amino-2-oxoethoxy)phenyl]-5,7,7-tricyano-3,5,8,8a-tetrahydro-1H-isothiochromen-6-ylidene]azanium.
| Compound Name | [(5R,8R,8aR)-8-[3-(2-amino-2-oxoethoxy)phenyl]-5,7,7-tricyano-3,5,8,8a-tetrahydro-1H-isothiochromen-6-ylidene]azanium |
|---|---|
| PubChem CID | 7307291 |
| Molecular Formula | C20H18N5O2S+ |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [(5R,8R,8aR)-8-[3-(2-amino-2-oxoethoxy)phenyl]-5,7,7-tricyano-3,5,8,8a-tetrahydro-1H-isothiochromen-6-ylidene]azanium |
| SMILES | N#C[C@H]1C(=[NH2+])C(C#N)(C#N)[C@@H](c2cccc(OCC(N)=O)c2)[C@H]2CSCC=C12 |
| InChI | InChI=1S/C20H17N5O2S/c21-7-15-14-4-5-28-9-16(14)18(20(10-22,11-23)19(15)25)12-2-1-3-13(6-12)27-8-17(24)26/h1-4,6,15-16,18,25H,5,8-9H2,(H2,24,26)/p+1/t15-,16+,18+/m1/s1 |
| InChIKey | RDJGWKKDWQGTNZ-RYRKJORJSA-O |
| XLogP | 0.31 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|