C19H16ClN4+ — CID 7307905
[(1S,4S,4aR)-4-(4-chlorophenyl)-1,3,3-tricyano-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium (PubChem CID 7307905) has the molecular formula C19H16ClN4+ and a molecular weight of 335.82 g/mol. Its IUPAC name is [(1S,4S,4aR)-4-(4-chlorophenyl)-1,3,3-tricyano-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium.
| Compound Name | [(1S,4S,4aR)-4-(4-chlorophenyl)-1,3,3-tricyano-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium |
|---|---|
| PubChem CID | 7307905 |
| Molecular Formula | C19H16ClN4+ |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [(1S,4S,4aR)-4-(4-chlorophenyl)-1,3,3-tricyano-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium |
| SMILES | N#C[C@@H]1C(=[NH2+])C(C#N)(C#N)[C@H](c2ccc(Cl)cc2)[C@H]2CCCC=C12 |
| InChI | InChI=1S/C19H15ClN4/c20-13-7-5-12(6-8-13)17-15-4-2-1-3-14(15)16(9-21)18(24)19(17,10-22)11-23/h3,5-8,15-17,24H,1-2,4H2/p+1/t15-,16-,17+/m0/s1 |
| InChIKey | QNIIAEDOEKZPPW-YESZJQIVSA-O |
| XLogP | 2.54 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|