C20H17F2N4O+ — CID 7307232
[(1S,4R,4aR)-1,3,3-tricyano-4-[2-(difluoromethoxy)phenyl]-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium (PubChem CID 7307232) has the molecular formula C20H17F2N4O+ and a molecular weight of 367.38 g/mol. Its IUPAC name is [(1S,4R,4aR)-1,3,3-tricyano-4-[2-(difluoromethoxy)phenyl]-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium.
| Compound Name | [(1S,4R,4aR)-1,3,3-tricyano-4-[2-(difluoromethoxy)phenyl]-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium |
|---|---|
| PubChem CID | 7307232 |
| Molecular Formula | C20H17F2N4O+ |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [(1S,4R,4aR)-1,3,3-tricyano-4-[2-(difluoromethoxy)phenyl]-1,4,4a,5,6,7-hexahydronaphthalen-2-ylidene]azanium |
| SMILES | N#C[C@@H]1C(=[NH2+])C(C#N)(C#N)[C@H](c2ccccc2OC(F)F)[C@H]2CCCC=C12 |
| InChI | InChI=1S/C20H16F2N4O/c21-19(22)27-16-8-4-3-7-14(16)17-13-6-2-1-5-12(13)15(9-23)18(26)20(17,10-24)11-25/h3-5,7-8,13,15,17,19,26H,1-2,6H2/p+1/t13-,15-,17-/m0/s1 |
| InChIKey | NONXNFXFQTYTEL-QRTARXTBSA-O |
| XLogP | 2.49 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|