C22H19F2N5O3 — CID 5258774
ethyl 6-amino-5,7,7-tricyano-8-[2-(difluoromethoxy)phenyl]-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 5258774) has the molecular formula C22H19F2N5O3 and a molecular weight of 439.42 g/mol. Its IUPAC name is ethyl 6-amino-5,7,7-tricyano-8-[2-(difluoromethoxy)phenyl]-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | ethyl 6-amino-5,7,7-tricyano-8-[2-(difluoromethoxy)phenyl]-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 5258774 |
| Molecular Formula | C22H19F2N5O3 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | ethyl 6-amino-5,7,7-tricyano-8-[2-(difluoromethoxy)phenyl]-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | CCOC(=O)N1CC=C2C(C#N)=C(N)C(C#N)(C#N)C(c3ccccc3OC(F)F)C2C1 |
| InChI | InChI=1S/C22H19F2N5O3/c1-2-31-21(30)29-8-7-13-15(9-25)19(28)22(11-26,12-27)18(16(13)10-29)14-5-3-4-6-17(14)32-20(23)24/h3-7,16,18,20H,2,8,10,28H2,1H3 |
| InChIKey | ZOMLDHZQMQPVOO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|