C29H27N5O4 — CID 1386322
ethyl (8S,8aS)-6-amino-5,7,7-tricyano-8-(3-methoxy-4-phenylmethoxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate (PubChem CID 1386322) has the molecular formula C29H27N5O4 and a molecular weight of 509.57 g/mol. Its IUPAC name is ethyl (8S,8aS)-6-amino-5,7,7-tricyano-8-(3-methoxy-4-phenylmethoxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate.
| Compound Name | ethyl (8S,8aS)-6-amino-5,7,7-tricyano-8-(3-methoxy-4-phenylmethoxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 1386322 |
| Molecular Formula | C29H27N5O4 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | ethyl (8S,8aS)-6-amino-5,7,7-tricyano-8-(3-methoxy-4-phenylmethoxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-2-carboxylate |
| SMILES | CCOC(=O)N1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3ccc(OCc4ccccc4)c(OC)c3)[C@@H]2C1 |
| InChI | InChI=1S/C29H27N5O4/c1-3-37-28(35)34-12-11-21-22(14-30)27(33)29(17-31,18-32)26(23(21)15-34)20-9-10-24(25(13-20)36-2)38-16-19-7-5-4-6-8-19/h4-11,13,23,26H,3,12,15-16,33H2,1-2H3/t23-,26-/m1/s1 |
| InChIKey | OJFUGHLQVGPIMB-ZEQKJWHPSA-N |
| XLogP | 4.16 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|