C29H29N5O2 — CID 51651014
(8R,8aS)-6-amino-2-benzyl-8-(3,4-diethoxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 51651014) has the molecular formula C29H29N5O2 and a molecular weight of 479.58 g/mol. Its IUPAC name is (8R,8aS)-6-amino-2-benzyl-8-(3,4-diethoxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8R,8aS)-6-amino-2-benzyl-8-(3,4-diethoxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 51651014 |
| Molecular Formula | C29H29N5O2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | (8R,8aS)-6-amino-2-benzyl-8-(3,4-diethoxyphenyl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CCOc1ccc([C@H]2[C@@H]3CN(Cc4ccccc4)CC=C3C(C#N)=C(N)C2(C#N)C#N)cc1OCC |
| InChI | InChI=1S/C29H29N5O2/c1-3-35-25-11-10-21(14-26(25)36-4-2)27-24-17-34(16-20-8-6-5-7-9-20)13-12-22(24)23(15-30)28(33)29(27,18-31)19-32/h5-12,14,24,27H,3-4,13,16-17,33H2,1-2H3/t24-,27+/m1/s1 |
| InChIKey | JMKNFYDGWNBPMC-SQHAQQRYSA-N |
| XLogP | 4.41 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|