C27H23N5O2 — CID 11838473
methyl 4-[(8S,8aR)-6-amino-2-benzyl-5,7,7-tricyano-1,3,8,8a-tetrahydroisoquinolin-8-yl]benzoate (PubChem CID 11838473) has the molecular formula C27H23N5O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is methyl 4-[(8S,8aR)-6-amino-2-benzyl-5,7,7-tricyano-1,3,8,8a-tetrahydroisoquinolin-8-yl]benzoate.
| Compound Name | methyl 4-[(8S,8aR)-6-amino-2-benzyl-5,7,7-tricyano-1,3,8,8a-tetrahydroisoquinolin-8-yl]benzoate |
|---|---|
| PubChem CID | 11838473 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | methyl 4-[(8S,8aR)-6-amino-2-benzyl-5,7,7-tricyano-1,3,8,8a-tetrahydroisoquinolin-8-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2[C@H]3CN(Cc4ccccc4)CC=C3C(C#N)=C(N)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C27H23N5O2/c1-34-26(33)20-9-7-19(8-10-20)24-23-15-32(14-18-5-3-2-4-6-18)12-11-21(23)22(13-28)25(31)27(24,16-29)17-30/h2-11,23-24H,12,14-15,31H2,1H3/t23-,24+/m0/s1 |
| InChIKey | RAIQHHAYLDMDRD-BJKOFHAPSA-N |
| XLogP | 3.40 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|